C22H31N5O2 — CID 135933159
2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-4-(piperidin-1-ylmethyl)-1H-pyrimidin-6-one (PubChem CID 135933159) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-4-(piperidin-1-ylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-4-(piperidin-1-ylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135933159 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]-4-(piperidin-1-ylmethyl)-1H-pyrimidin-6-one |
| SMILES | COc1ccccc1CN1CCN(c2nc(CN3CCCCC3)cc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C22H31N5O2/c1-29-20-8-4-3-7-18(20)16-26-11-13-27(14-12-26)22-23-19(15-21(28)24-22)17-25-9-5-2-6-10-25/h3-4,7-8,15H,2,5-6,9-14,16-17H2,1H3,(H,23,24,28) |
| InChIKey | DMFGTMNAEDGBAK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 64.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |