C31H40N6O3 — CID 136811682
2-[4-(4-butylbenzoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one (PubChem CID 136811682) has the molecular formula C31H40N6O3 and a molecular weight of 544.70 g/mol. Its IUPAC name is 2-[4-(4-butylbenzoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(4-butylbenzoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136811682 |
| Molecular Formula | C31H40N6O3 |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.32 |
| IUPAC Name | 2-[4-(4-butylbenzoyl)piperazin-1-yl]-4-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one |
| SMILES | CCCCc1ccc(C(=O)N2CCN(c3nc(CN4CCN(c5ccc(OC)cc5)CC4)cc(=O)[nH]3)CC2)cc1 |
| InChI | InChI=1S/C31H40N6O3/c1-3-4-5-24-6-8-25(9-7-24)30(39)36-18-20-37(21-19-36)31-32-26(22-29(38)33-31)23-34-14-16-35(17-15-34)27-10-12-28(40-2)13-11-27/h6-13,22H,3-5,14-21,23H2,1-2H3,(H,32,33,38) |
| InChIKey | JSZHSMUSZLXHLF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|