C30H38N6O2 — CID 135933372
4-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-2-[4-(4-ethylbenzoyl)piperazin-1-yl]-1H-pyrimidin-6-one (PubChem CID 135933372) has the molecular formula C30H38N6O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-2-[4-(4-ethylbenzoyl)piperazin-1-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-2-[4-(4-ethylbenzoyl)piperazin-1-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135933372 |
| Molecular Formula | C30H38N6O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | 4-[[4-(3,4-dimethylphenyl)piperazin-1-yl]methyl]-2-[4-(4-ethylbenzoyl)piperazin-1-yl]-1H-pyrimidin-6-one |
| SMILES | CCc1ccc(C(=O)N2CCN(c3nc(CN4CCN(c5ccc(C)c(C)c5)CC4)cc(=O)[nH]3)CC2)cc1 |
| InChI | InChI=1S/C30H38N6O2/c1-4-24-6-8-25(9-7-24)29(38)35-15-17-36(18-16-35)30-31-26(20-28(37)32-30)21-33-11-13-34(14-12-33)27-10-5-22(2)23(3)19-27/h5-10,19-20H,4,11-18,21H2,1-3H3,(H,31,32,37) |
| InChIKey | RHHMMHGOYZLRME-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 75.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|