C27H31N7O4 — CID 135933306
2-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]-4-[(4-phenylpiperazin-1-yl)methyl]-1H-pyrimidin-6-one (PubChem CID 135933306) has the molecular formula C27H31N7O4 and a molecular weight of 517.59 g/mol. Its IUPAC name is 2-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]-4-[(4-phenylpiperazin-1-yl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]-4-[(4-phenylpiperazin-1-yl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135933306 |
| Molecular Formula | C27H31N7O4 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 2-[4-(3-nitrobenzoyl)-1,4-diazepan-1-yl]-4-[(4-phenylpiperazin-1-yl)methyl]-1H-pyrimidin-6-one |
| SMILES | O=C(c1cccc([N+](=O)[O-])c1)N1CCCN(c2nc(CN3CCN(c4ccccc4)CC3)cc(=O)[nH]2)CC1 |
| InChI | InChI=1S/C27H31N7O4/c35-25-19-22(20-30-12-14-31(15-13-30)23-7-2-1-3-8-23)28-27(29-25)33-11-5-10-32(16-17-33)26(36)21-6-4-9-24(18-21)34(37)38/h1-4,6-9,18-19H,5,10-17,20H2,(H,28,29,35) |
| InChIKey | AFFMNBLXVOTLGG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 118.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|