C28H33ClN6O3 — CID 135933432
2-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-4-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one (PubChem CID 135933432) has the molecular formula C28H33ClN6O3 and a molecular weight of 537.06 g/mol. Its IUPAC name is 2-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-4-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-4-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135933432 |
| Molecular Formula | C28H33ClN6O3 |
| Molecular Weight | 537.06 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2-[4-[2-(4-chlorophenoxy)acetyl]piperazin-1-yl]-4-[[4-(4-methylphenyl)piperazin-1-yl]methyl]-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(N2CCN(Cc3cc(=O)[nH]c(N4CCN(C(=O)COc5ccc(Cl)cc5)CC4)n3)CC2)cc1 |
| InChI | InChI=1S/C28H33ClN6O3/c1-21-2-6-24(7-3-21)33-12-10-32(11-13-33)19-23-18-26(36)31-28(30-23)35-16-14-34(15-17-35)27(37)20-38-25-8-4-22(29)5-9-25/h2-9,18H,10-17,19-20H2,1H3,(H,30,31,36) |
| InChIKey | GBWZVNJXJYNSRX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.06 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|