C25H20N4O3 — CID 135645911
N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-9H-xanthene-9-carboxamide (PubChem CID 135645911) has the molecular formula C25H20N4O3 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-9H-xanthene-9-carboxamide.
| Compound Name | N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-9H-xanthene-9-carboxamide |
|---|---|
| PubChem CID | 135645911 |
| Molecular Formula | C25H20N4O3 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]-9H-xanthene-9-carboxamide |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N/NC(=O)C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C25H20N4O3/c1-16-20(25(31)29(28-16)17-9-3-2-4-10-17)15-26-27-24(30)23-18-11-5-7-13-21(18)32-22-14-8-6-12-19(22)23/h2-15,23,28H,1H3,(H,27,30)/b26-15+ |
| InChIKey | OWUCGGZRQROCLU-CVKSISIWSA-N |
| XLogP | 3.86 |
| TPSA | 88.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|