C18H16N4O2S — CID 171980572
2-hydroxy-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzenecarbothioamide (PubChem CID 171980572) has the molecular formula C18H16N4O2S and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-hydroxy-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzenecarbothioamide.
| Compound Name | 2-hydroxy-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 171980572 |
| Molecular Formula | C18H16N4O2S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 2-hydroxy-N-[(E)-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)methylideneamino]benzenecarbothioamide |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=N/NC(=S)c1ccccc1O |
| InChI | InChI=1S/C18H16N4O2S/c1-12-15(18(24)22(21-12)13-7-3-2-4-8-13)11-19-20-17(25)14-9-5-6-10-16(14)23/h2-11,21,23H,1H3,(H,20,25)/b19-11+ |
| InChIKey | XKSNNYUJIUMFLN-YBFXNURJSA-N |
| XLogP | 2.48 |
| TPSA | 82.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|