C19H18F3N5O3 — CID 135646462
5-(3-methoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 135646462) has the molecular formula C19H18F3N5O3 and a molecular weight of 421.38 g/mol. Its IUPAC name is 5-(3-methoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | 5-(3-methoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 135646462 |
| Molecular Formula | C19H18F3N5O3 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 5-(3-methoxyphenyl)-N-(5-methyl-1,2-oxazol-3-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COc1cccc(C2CC(C(F)(F)F)n3nc(C(=O)Nc4cc(C)on4)cc3N2)c1 |
| InChI | InChI=1S/C19H18F3N5O3/c1-10-6-16(26-30-10)24-18(28)14-9-17-23-13(11-4-3-5-12(7-11)29-2)8-15(19(20,21)22)27(17)25-14/h3-7,9,13,15,23H,8H2,1-2H3,(H,24,26,28) |
| InChIKey | ORSGRPSPYGYVPU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |