C19H18ClN3O2 — CID 135648428
N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide (PubChem CID 135648428) has the molecular formula C19H18ClN3O2 and a molecular weight of 355.83 g/mol. Its IUPAC name is N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide.
| Compound Name | N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 135648428 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-[(Z)-(2-chloro-1H-indol-3-yl)methylideneamino]-2-(3,4-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)N/N=C\c2c(Cl)[nH]c3ccccc23)cc1C |
| InChI | InChI=1S/C19H18ClN3O2/c1-12-7-8-14(9-13(12)2)25-11-18(24)23-21-10-16-15-5-3-4-6-17(15)22-19(16)20/h3-10,22H,11H2,1-2H3,(H,23,24)/b21-10- |
| InChIKey | NBLHIRUOALTHBL-FBHDLOMBSA-N |
| XLogP | 3.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|