C21H21N3O6 — CID 135649342
methyl 2-[(5-cyano-2-hydroxy-4-methyl-6-oxo-1-prop-2-enyl-3-pyridinyl)methylideneamino]-4,5-dimethoxybenzoate (PubChem CID 135649342) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is methyl 2-[(5-cyano-2-hydroxy-4-methyl-6-oxo-1-prop-2-enyl-3-pyridinyl)methylideneamino]-4,5-dimethoxybenzoate.
| Compound Name | methyl 2-[(5-cyano-2-hydroxy-4-methyl-6-oxo-1-prop-2-enyl-3-pyridinyl)methylideneamino]-4,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 135649342 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | methyl 2-[(5-cyano-2-hydroxy-4-methyl-6-oxo-1-prop-2-enyl-3-pyridinyl)methylideneamino]-4,5-dimethoxybenzoate |
| SMILES | C=CCn1c(O)c(/C=N/c2cc(OC)c(OC)cc2C(=O)OC)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C21H21N3O6/c1-6-7-24-19(25)14(10-22)12(2)15(20(24)26)11-23-16-9-18(29-4)17(28-3)8-13(16)21(27)30-5/h6,8-9,11,26H,1,7H2,2-5H3/b23-11+ |
| InChIKey | VCGDRVWGSAEYKN-FOKLQQMPSA-N |
| XLogP | 2.47 |
| TPSA | 123.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|