C21H24N6O — CID 135649679
4-(4-methyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-2-(2-phenylethylamino)-1H-pyrimidin-6-one (PubChem CID 135649679) has the molecular formula C21H24N6O and a molecular weight of 376.46 g/mol. Its IUPAC name is 4-(4-methyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-2-(2-phenylethylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(4-methyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-2-(2-phenylethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135649679 |
| Molecular Formula | C21H24N6O |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 4-(4-methyl-2-pyrrolidin-1-ylpyrimidin-5-yl)-2-(2-phenylethylamino)-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N2CCCC2)ncc1-c1cc(=O)[nH]c(NCCc2ccccc2)n1 |
| InChI | InChI=1S/C21H24N6O/c1-15-17(14-23-21(24-15)27-11-5-6-12-27)18-13-19(28)26-20(25-18)22-10-9-16-7-3-2-4-8-16/h2-4,7-8,13-14H,5-6,9-12H2,1H3,(H2,22,25,26,28) |
| InChIKey | RXPOBNPMHWYZIH-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |