C20H23N3O4S — CID 135652007
2-[1-[[(6-hydroxy-4-oxo-1-phenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]methyl]cyclohexyl]acetic acid (PubChem CID 135652007) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 2-[1-[[(6-hydroxy-4-oxo-1-phenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]methyl]cyclohexyl]acetic acid.
| Compound Name | 2-[1-[[(6-hydroxy-4-oxo-1-phenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]methyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 135652007 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[1-[[(6-hydroxy-4-oxo-1-phenyl-2-sulfanylidenepyrimidin-5-yl)methylideneamino]methyl]cyclohexyl]acetic acid |
| SMILES | O=C(O)CC1(C/N=C/c2c(O)n(-c3ccccc3)c(=S)[nH]c2=O)CCCCC1 |
| InChI | InChI=1S/C20H23N3O4S/c24-16(25)11-20(9-5-2-6-10-20)13-21-12-15-17(26)22-19(28)23(18(15)27)14-7-3-1-4-8-14/h1,3-4,7-8,12,27H,2,5-6,9-11,13H2,(H,24,25)(H,22,26,28)/b21-12+ |
| InChIKey | HCQBFZWMDQJAOR-CIAFOILYSA-N |
| XLogP | 3.44 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|