C27H23N3O3 — CID 135652561
5-[4-[(2-methylphenyl)methoxy]phenyl]-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135652561) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 5-[4-[(2-methylphenyl)methoxy]phenyl]-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | 5-[4-[(2-methylphenyl)methoxy]phenyl]-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135652561 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 5-[4-[(2-methylphenyl)methoxy]phenyl]-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | Cc1ccccc1COc1ccc(C2CC(=O)Nc3nc(-c4ccccc4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C27H23N3O3/c1-17-7-5-6-10-20(17)16-33-21-13-11-18(12-14-21)22-15-23(31)28-26-24(22)27(32)30-25(29-26)19-8-3-2-4-9-19/h2-14,22H,15-16H2,1H3,(H2,28,29,30,31,32) |
| InChIKey | YNEUGJCGXNCEBK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |