C19H13F2N3O2 — CID 135774801
(5R)-5-(3,5-difluorophenyl)-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione (PubChem CID 135774801) has the molecular formula C19H13F2N3O2 and a molecular weight of 353.33 g/mol. Its IUPAC name is (5R)-5-(3,5-difluorophenyl)-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione.
| Compound Name | (5R)-5-(3,5-difluorophenyl)-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 135774801 |
| Molecular Formula | C19H13F2N3O2 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | (5R)-5-(3,5-difluorophenyl)-2-phenyl-3,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-4,7-dione |
| SMILES | O=C1C[C@H](c2cc(F)cc(F)c2)c2c(nc(-c3ccccc3)[nH]c2=O)N1 |
| InChI | InChI=1S/C19H13F2N3O2/c20-12-6-11(7-13(21)8-12)14-9-15(25)22-18-16(14)19(26)24-17(23-18)10-4-2-1-3-5-10/h1-8,14H,9H2,(H2,22,23,24,25,26)/t14-/m1/s1 |
| InChIKey | IXBAXGDBHQEDAP-CQSZACIVSA-N |
| XLogP | 3.19 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |