C28H29N5O5 — CID 135653587
N-(3-ethanehydrazonoylphenyl)-2-[4-[4-(2-ethoxyphenoxy)-5-methyl-1H-pyrazol-3-yl]-3-hydroxyphenoxy]acetamide (PubChem CID 135653587) has the molecular formula C28H29N5O5 and a molecular weight of 515.57 g/mol. Its IUPAC name is N-(3-ethanehydrazonoylphenyl)-2-[4-[4-(2-ethoxyphenoxy)-5-methyl-1H-pyrazol-3-yl]-3-hydroxyphenoxy]acetamide.
| Compound Name | N-(3-ethanehydrazonoylphenyl)-2-[4-[4-(2-ethoxyphenoxy)-5-methyl-1H-pyrazol-3-yl]-3-hydroxyphenoxy]acetamide |
|---|---|
| PubChem CID | 135653587 |
| Molecular Formula | C28H29N5O5 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | N-(3-ethanehydrazonoylphenyl)-2-[4-[4-(2-ethoxyphenoxy)-5-methyl-1H-pyrazol-3-yl]-3-hydroxyphenoxy]acetamide |
| SMILES | CCOc1ccccc1Oc1c(-c2ccc(OCC(=O)Nc3cccc(/C(C)=N/N)c3)cc2O)n[nH]c1C |
| InChI | InChI=1S/C28H29N5O5/c1-4-36-24-10-5-6-11-25(24)38-28-18(3)32-33-27(28)22-13-12-21(15-23(22)34)37-16-26(35)30-20-9-7-8-19(14-20)17(2)31-29/h5-15,34H,4,16,29H2,1-3H3,(H,30,35)(H,32,33)/b31-17+ |
| InChIKey | TWOLHTKQBJMFQV-KBVAKVRCSA-N |
| XLogP | 4.98 |
| TPSA | 144.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|