C26H33N5O2 — CID 135659227
5-[4-(diethylamino)phenyl]-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135659227) has the molecular formula C26H33N5O2 and a molecular weight of 447.58 g/mol. Its IUPAC name is 5-[4-(diethylamino)phenyl]-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | 5-[4-(diethylamino)phenyl]-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135659227 |
| Molecular Formula | C26H33N5O2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | 5-[4-(diethylamino)phenyl]-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | CCN(CC)c1ccc(C2C3=C(CCCC3=O)Nc3nc(N4CCCCC4)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C26H33N5O2/c1-3-30(4-2)18-13-11-17(12-14-18)21-22-19(9-8-10-20(22)32)27-24-23(21)25(33)29-26(28-24)31-15-6-5-7-16-31/h11-14,21H,3-10,15-16H2,1-2H3,(H2,27,28,29,33) |
| InChIKey | UIMPIVHQLXPGTC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |