C22H22Cl2N4O2 — CID 135904394
(5R)-5-(2,4-dichlorophenyl)-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione (PubChem CID 135904394) has the molecular formula C22H22Cl2N4O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is (5R)-5-(2,4-dichlorophenyl)-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione.
| Compound Name | (5R)-5-(2,4-dichlorophenyl)-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
|---|---|
| PubChem CID | 135904394 |
| Molecular Formula | C22H22Cl2N4O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | (5R)-5-(2,4-dichlorophenyl)-2-piperidin-1-yl-3,5,7,8,9,10-hexahydropyrimido[4,5-b]quinoline-4,6-dione |
| SMILES | O=C1CCCC2=C1[C@@H](c1ccc(Cl)cc1Cl)c1c(nc(N3CCCCC3)[nH]c1=O)N2 |
| InChI | InChI=1S/C22H22Cl2N4O2/c23-12-7-8-13(14(24)11-12)17-18-15(5-4-6-16(18)29)25-20-19(17)21(30)27-22(26-20)28-9-2-1-3-10-28/h7-8,11,17H,1-6,9-10H2,(H2,25,26,27,30)/t17-/m1/s1 |
| InChIKey | NDDAMUAEULNYRF-QGZVFWFLSA-N |
| XLogP | 4.63 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |