C30H31N5O3 — CID 135660609
N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(2-phenylethoxy)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135660609) has the molecular formula C30H31N5O3 and a molecular weight of 509.61 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(2-phenylethoxy)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(2-phenylethoxy)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135660609 |
| Molecular Formula | C30H31N5O3 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | N-(2,3-dimethylphenyl)-7-[3-methoxy-4-(2-phenylethoxy)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(C2C(C(=O)Nc3cccc(C)c3C)=C(C)Nc3ncnn32)ccc1OCCc1ccccc1 |
| InChI | InChI=1S/C30H31N5O3/c1-19-9-8-12-24(20(19)2)34-29(36)27-21(3)33-30-31-18-32-35(30)28(27)23-13-14-25(26(17-23)37-4)38-16-15-22-10-6-5-7-11-22/h5-14,17-18,28H,15-16H2,1-4H3,(H,34,36)(H,31,32,33) |
| InChIKey | VHRAWTSKLZJUSM-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |