C34H34BrClN4O4S — CID 135664355
prop-2-enyl 7-[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135664355) has the molecular formula C34H34BrClN4O4S and a molecular weight of 710.09 g/mol. Its IUPAC name is prop-2-enyl 7-[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | prop-2-enyl 7-[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135664355 |
| Molecular Formula | C34H34BrClN4O4S |
| Molecular Weight | 710.09 g/mol |
| Exact Mass | 708.12 |
| IUPAC Name | prop-2-enyl 7-[3-bromo-5-methoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | C=CCOC(=O)C1=C(C)Nc2nc(SCc3ccccc3Cl)nn2C1c1cc(Br)c(OCc2cc(C)c(C)cc2C)c(OC)c1 |
| InChI | InChI=1S/C34H34BrClN4O4S/c1-7-12-43-32(41)29-22(5)37-33-38-34(45-18-23-10-8-9-11-27(23)36)39-40(33)30(29)24-15-26(35)31(28(16-24)42-6)44-17-25-14-20(3)19(2)13-21(25)4/h7-11,13-16,30H,1,12,17-18H2,2-6H3,(H,37,38,39) |
| InChIKey | WAQGYHBDNKPMCD-UHFFFAOYSA-N |
| XLogP | 8.52 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.09 |
| LogP ≤ 5 | 8.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|