C28H31BrClN5O4S — CID 135664395
2-[4-[6-acetyl-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-2-bromo-6-methoxyphenoxy]-N,N-diethylacetamide (PubChem CID 135664395) has the molecular formula C28H31BrClN5O4S and a molecular weight of 649.01 g/mol. Its IUPAC name is 2-[4-[6-acetyl-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-2-bromo-6-methoxyphenoxy]-N,N-diethylacetamide.
| Compound Name | 2-[4-[6-acetyl-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-2-bromo-6-methoxyphenoxy]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 135664395 |
| Molecular Formula | C28H31BrClN5O4S |
| Molecular Weight | 649.01 g/mol |
| Exact Mass | 647.10 |
| IUPAC Name | 2-[4-[6-acetyl-2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl]-2-bromo-6-methoxyphenoxy]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)COc1c(Br)cc(C2C(C(C)=O)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc1OC |
| InChI | InChI=1S/C28H31BrClN5O4S/c1-6-34(7-2)23(37)14-39-26-20(29)12-19(13-22(26)38-5)25-24(17(4)36)16(3)31-27-32-28(33-35(25)27)40-15-18-10-8-9-11-21(18)30/h8-13,25H,6-7,14-15H2,1-5H3,(H,31,32,33) |
| InChIKey | IEDQZYBTNAOZPQ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.01 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |