C24H25ClN4O5S — CID 135664911
methyl 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135664911) has the molecular formula C24H25ClN4O5S and a molecular weight of 517.01 g/mol. Its IUPAC name is methyl 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | methyl 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135664911 |
| Molecular Formula | C24H25ClN4O5S |
| Molecular Weight | 517.01 g/mol |
| Exact Mass | 516.12 |
| IUPAC Name | methyl 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | COC(=O)C1=C(C)Nc2nc(SCc3ccccc3Cl)nn2C1c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C24H25ClN4O5S/c1-13-19(22(30)34-5)20(15-10-17(31-2)21(33-4)18(11-15)32-3)29-23(26-13)27-24(28-29)35-12-14-8-6-7-9-16(14)25/h6-11,20H,12H2,1-5H3,(H,26,27,28) |
| InChIKey | KGZFUOSHCHCPEH-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.01 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |