C23H24ClN5O4S — CID 4050716
2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 4050716) has the molecular formula C23H24ClN5O4S and a molecular weight of 502.00 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 4050716 |
| Molecular Formula | C23H24ClN5O4S |
| Molecular Weight | 502.00 g/mol |
| Exact Mass | 501.12 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-5-methyl-7-(3,4,5-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(C2C(C(N)=O)=C(C)Nc3nc(SCc4ccccc4Cl)nn32)cc(OC)c1OC |
| InChI | InChI=1S/C23H24ClN5O4S/c1-12-18(21(25)30)19(14-9-16(31-2)20(33-4)17(10-14)32-3)29-22(26-12)27-23(28-29)34-11-13-7-5-6-8-15(13)24/h5-10,19H,11H2,1-4H3,(H2,25,30)(H,26,27,28) |
| InChIKey | AHTUMCIICJUBMN-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.00 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |