C20H16Cl3N5OS — CID 135819251
2-[(2-chlorophenyl)methylsulfanyl]-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135819251) has the molecular formula C20H16Cl3N5OS and a molecular weight of 480.81 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methylsulfanyl]-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135819251 |
| Molecular Formula | C20H16Cl3N5OS |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 479.01 |
| IUPAC Name | 2-[(2-chlorophenyl)methylsulfanyl]-7-(2,4-dichlorophenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | CC1=C(C(N)=O)C(c2ccc(Cl)cc2Cl)n2nc(SCc3ccccc3Cl)nc2N1 |
| InChI | InChI=1S/C20H16Cl3N5OS/c1-10-16(18(24)29)17(13-7-6-12(21)8-15(13)23)28-19(25-10)26-20(27-28)30-9-11-4-2-3-5-14(11)22/h2-8,17H,9H2,1H3,(H2,24,29)(H,25,26,27) |
| InChIKey | JXPSRQSWVZWSAN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |