C28H24N6O3 — CID 135666174
7-(4-cyanophenyl)-2-(3,5-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135666174) has the molecular formula C28H24N6O3 and a molecular weight of 492.54 g/mol. Its IUPAC name is 7-(4-cyanophenyl)-2-(3,5-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-(4-cyanophenyl)-2-(3,5-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135666174 |
| Molecular Formula | C28H24N6O3 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 7-(4-cyanophenyl)-2-(3,5-dimethoxyphenyl)-5-methyl-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(OC)cc(-c2nc3n(n2)C(c2ccc(C#N)cc2)C(C(=O)Nc2ccccc2)=C(C)N3)c1 |
| InChI | InChI=1S/C28H24N6O3/c1-17-24(27(35)31-21-7-5-4-6-8-21)25(19-11-9-18(16-29)10-12-19)34-28(30-17)32-26(33-34)20-13-22(36-2)15-23(14-20)37-3/h4-15,25H,1-3H3,(H,31,35)(H,30,32,33) |
| InChIKey | SKLVAAZNUNUXMA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |