C26H25N5O4 — CID 135815494
2-(3,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135815494) has the molecular formula C26H25N5O4 and a molecular weight of 471.52 g/mol. Its IUPAC name is 2-(3,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 2-(3,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135815494 |
| Molecular Formula | C26H25N5O4 |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 2-(3,5-dimethoxyphenyl)-5-methyl-7-(5-methylfuran-2-yl)-N-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1cc(OC)cc(-c2nc3n(n2)C(c2ccc(C)o2)C(C(=O)Nc2ccccc2)=C(C)N3)c1 |
| InChI | InChI=1S/C26H25N5O4/c1-15-10-11-21(35-15)23-22(25(32)28-18-8-6-5-7-9-18)16(2)27-26-29-24(30-31(23)26)17-12-19(33-3)14-20(13-17)34-4/h5-14,23H,1-4H3,(H,28,32)(H,27,29,30) |
| InChIKey | YMSMNFYDNVIIGH-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |