C21H22F3N3O2 — CID 135668558
1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[[2-(trifluoromethyl)phenyl]iminomethyl]pyridine-3-carbonitrile (PubChem CID 135668558) has the molecular formula C21H22F3N3O2 and a molecular weight of 405.42 g/mol. Its IUPAC name is 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[[2-(trifluoromethyl)phenyl]iminomethyl]pyridine-3-carbonitrile.
| Compound Name | 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[[2-(trifluoromethyl)phenyl]iminomethyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135668558 |
| Molecular Formula | C21H22F3N3O2 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-hexyl-6-hydroxy-4-methyl-2-oxo-5-[[2-(trifluoromethyl)phenyl]iminomethyl]pyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(/C=N/c2ccccc2C(F)(F)F)c(C)c(C#N)c1=O |
| InChI | InChI=1S/C21H22F3N3O2/c1-3-4-5-8-11-27-19(28)15(12-25)14(2)16(20(27)29)13-26-18-10-7-6-9-17(18)21(22,23)24/h6-7,9-10,13,29H,3-5,8,11H2,1-2H3/b26-13+ |
| InChIKey | JILJPOCANOHICN-LGJNPRDNSA-N |
| XLogP | 5.08 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|