C26H30F3N3O2 — CID 91067845
5-[3-[4-(diethylamino)phenyl]propa-1,2-dienyl]-1-hexyl-6-hydroxy-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile (PubChem CID 91067845) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is 5-[3-[4-(diethylamino)phenyl]propa-1,2-dienyl]-1-hexyl-6-hydroxy-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile.
| Compound Name | 5-[3-[4-(diethylamino)phenyl]propa-1,2-dienyl]-1-hexyl-6-hydroxy-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 91067845 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | 5-[3-[4-(diethylamino)phenyl]propa-1,2-dienyl]-1-hexyl-6-hydroxy-2-oxo-4-(trifluoromethyl)pyridine-3-carbonitrile |
| SMILES | CCCCCCn1c(O)c(C=C=Cc2ccc(N(CC)CC)cc2)c(C(F)(F)F)c(C#N)c1=O |
| InChI | InChI=1S/C26H30F3N3O2/c1-4-7-8-9-17-32-24(33)21(23(26(27,28)29)22(18-30)25(32)34)12-10-11-19-13-15-20(16-14-19)31(5-2)6-3/h11-16,33H,4-9,17H2,1-3H3 |
| InChIKey | PPVGUKMWEYCCJK-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|