C28H21N3O3 — CID 135669282
5-[(2-benzoylphenyl)iminomethyl]-1-benzyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile (PubChem CID 135669282) has the molecular formula C28H21N3O3 and a molecular weight of 447.49 g/mol. Its IUPAC name is 5-[(2-benzoylphenyl)iminomethyl]-1-benzyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 5-[(2-benzoylphenyl)iminomethyl]-1-benzyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 135669282 |
| Molecular Formula | C28H21N3O3 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 5-[(2-benzoylphenyl)iminomethyl]-1-benzyl-6-hydroxy-4-methyl-2-oxopyridine-3-carbonitrile |
| SMILES | Cc1c(/C=N/c2ccccc2C(=O)c2ccccc2)c(O)n(Cc2ccccc2)c(=O)c1C#N |
| InChI | InChI=1S/C28H21N3O3/c1-19-23(16-29)27(33)31(18-20-10-4-2-5-11-20)28(34)24(19)17-30-25-15-9-8-14-22(25)26(32)21-12-6-3-7-13-21/h2-15,17,34H,18H2,1H3/b30-17+ |
| InChIKey | RGYCSELXZVAAGP-OCSSWDANSA-N |
| XLogP | 4.76 |
| TPSA | 95.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|