C16H17N5O2S — CID 135674822
(2Z,5S)-5-methyl-2-[(E)-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135674822) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is (2Z,5S)-5-methyl-2-[(E)-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5S)-5-methyl-2-[(E)-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135674822 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (2Z,5S)-5-methyl-2-[(E)-1-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)ethylidenehydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | C/C(=N\N=C1\NC(=O)[C@H](C)S1)c1c(C)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C16H17N5O2S/c1-9(18-19-16-17-14(22)11(3)24-16)13-10(2)20-21(15(13)23)12-7-5-4-6-8-12/h4-8,11,20H,1-3H3,(H,17,19,22)/b18-9+/t11-/m0/s1 |
| InChIKey | SFHVNKVGBGXFCA-KECVIQKOSA-N |
| XLogP | 1.81 |
| TPSA | 91.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|