C22H16N4O2 — CID 135676290
6-[(E)-2-(2-nitrophenyl)ethenyl]-5,6-dihydrobenzimidazolo[1,2-c]quinazoline (PubChem CID 135676290) has the molecular formula C22H16N4O2 and a molecular weight of 368.40 g/mol. Its IUPAC name is 6-[(E)-2-(2-nitrophenyl)ethenyl]-5,6-dihydrobenzimidazolo[1,2-c]quinazoline.
| Compound Name | 6-[(E)-2-(2-nitrophenyl)ethenyl]-5,6-dihydrobenzimidazolo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 135676290 |
| Molecular Formula | C22H16N4O2 |
| Molecular Weight | 368.40 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 6-[(E)-2-(2-nitrophenyl)ethenyl]-5,6-dihydrobenzimidazolo[1,2-c]quinazoline |
| SMILES | O=[N+]([O-])c1ccccc1/C=C/C1Nc2ccccc2-c2nc3ccccc3n21 |
| InChI | InChI=1S/C22H16N4O2/c27-26(28)19-11-5-1-7-15(19)13-14-21-23-17-9-3-2-8-16(17)22-24-18-10-4-6-12-20(18)25(21)22/h1-14,21,23H/b14-13+ |
| InChIKey | DLQGISXKTQZHIR-BUHFOSPRSA-N |
| XLogP | 5.25 |
| TPSA | 72.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.40 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|