C22H18FN3O4 — CID 135677852
[(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate (PubChem CID 135677852) has the molecular formula C22H18FN3O4 and a molecular weight of 407.40 g/mol. Its IUPAC name is [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate.
| Compound Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 135677852 |
| Molecular Formula | C22H18FN3O4 |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | [(2S)-1-(4-fluoroanilino)-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1/N=N/c1ccc(O)cc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C22H18FN3O4/c1-14(21(28)24-16-8-6-15(23)7-9-16)30-22(29)19-4-2-3-5-20(19)26-25-17-10-12-18(27)13-11-17/h2-14,27H,1H3,(H,24,28)/b26-25+/t14-/m0/s1 |
| InChIKey | OHNVHZUDYISPBS-RJDXDPGKSA-N |
| XLogP | 5.13 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|