C21H16Cl2N4O4 — CID 136882140
[(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate (PubChem CID 136882140) has the molecular formula C21H16Cl2N4O4 and a molecular weight of 459.29 g/mol. Its IUPAC name is [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate.
| Compound Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 136882140 |
| Molecular Formula | C21H16Cl2N4O4 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | [(2S)-1-[(3,5-dichloro-2-pyridinyl)amino]-1-oxopropan-2-yl] 2-[(4-hydroxyphenyl)diazenyl]benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1/N=N/c1ccc(O)cc1)C(=O)Nc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C21H16Cl2N4O4/c1-12(20(29)25-19-17(23)10-13(22)11-24-19)31-21(30)16-4-2-3-5-18(16)27-26-14-6-8-15(28)9-7-14/h2-12,28H,1H3,(H,24,25,29)/b27-26+/t12-/m0/s1 |
| InChIKey | TVXWJIJKPCYATF-FZMQBDARSA-N |
| XLogP | 5.69 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|