C23H42O6 — CID 135678163
(6E,10E,12S,13R)-13-(2-hydroxyethyl)-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one (PubChem CID 135678163) has the molecular formula C23H42O6 and a molecular weight of 414.58 g/mol. Its IUPAC name is (6E,10E,12S,13R)-13-(2-hydroxyethyl)-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one.
| Compound Name | (6E,10E,12S,13R)-13-(2-hydroxyethyl)-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one |
|---|---|
| PubChem CID | 135678163 |
| Molecular Formula | C23H42O6 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (6E,10E,12S,13R)-13-(2-hydroxyethyl)-12,15-bis(methoxymethoxy)-6,10-dimethylpentadeca-6,10-dien-2-one |
| SMILES | COCOCC[C@@H](CCO)[C@@H](/C=C(\C)CC/C=C(\C)CCCC(C)=O)OCOC |
| InChI | InChI=1S/C23H42O6/c1-19(9-7-11-21(3)25)8-6-10-20(2)16-23(29-18-27-5)22(12-14-24)13-15-28-17-26-4/h8,16,22-24H,6-7,9-15,17-18H2,1-5H3/b19-8+,20-16+/t22-,23-/m1/s1 |
| InChIKey | CZIOROQBBGBRRZ-UEYHHRADSA-N |
| XLogP | 4.42 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|