C20H26N4O4 — CID 135680734
6-hydroxy-5-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 135680734) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 6-hydroxy-5-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135680734 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 6-hydroxy-5-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]iminomethyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | COc1ccccc1C(C/N=C/c1c(O)n(C)c(=O)n(C)c1=O)N1CCCC1 |
| InChI | InChI=1S/C20H26N4O4/c1-22-18(25)15(19(26)23(2)20(22)27)12-21-13-16(24-10-6-7-11-24)14-8-4-5-9-17(14)28-3/h4-5,8-9,12,16,25H,6-7,10-11,13H2,1-3H3/b21-12+ |
| InChIKey | YYWQNUVRPSNTQF-CIAFOILYSA-N |
| XLogP | 1.05 |
| TPSA | 89.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|