C16H14N2OS2 — CID 135680780
2-[[(E)-3-phenylprop-2-enyl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one (PubChem CID 135680780) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-[[(E)-3-phenylprop-2-enyl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[[(E)-3-phenylprop-2-enyl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 135680780 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-[[(E)-3-phenylprop-2-enyl]sulfanylmethyl]-3H-thieno[3,2-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(CSC/C=C/c2ccccc2)nc2ccsc12 |
| InChI | InChI=1S/C16H14N2OS2/c19-16-15-13(8-10-21-15)17-14(18-16)11-20-9-4-7-12-5-2-1-3-6-12/h1-8,10H,9,11H2,(H,17,18,19)/b7-4+ |
| InChIKey | IICSTVVIMISDII-QPJJXVBHSA-N |
| XLogP | 3.93 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|