C24H18F3N3O2S — CID 135687203
(E)-N-benzyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 135687203) has the molecular formula C24H18F3N3O2S and a molecular weight of 469.49 g/mol. Its IUPAC name is (E)-N-benzyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135687203 |
| Molecular Formula | C24H18F3N3O2S |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | (E)-N-benzyl-N-[(4-oxo-3H-thieno[3,2-d]pyrimidin-2-yl)methyl]-3-[4-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(C(F)(F)F)cc1)N(Cc1ccccc1)Cc1nc2ccsc2c(=O)[nH]1 |
| InChI | InChI=1S/C24H18F3N3O2S/c25-24(26,27)18-9-6-16(7-10-18)8-11-21(31)30(14-17-4-2-1-3-5-17)15-20-28-19-12-13-33-22(19)23(32)29-20/h1-13H,14-15H2,(H,28,29,32)/b11-8+ |
| InChIKey | UXMGGKWOKLGIAG-DHZHZOJOSA-N |
| XLogP | 5.25 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|