C27H23N3O4 — CID 135738149
(E)-N-benzyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide (PubChem CID 135738149) has the molecular formula C27H23N3O4 and a molecular weight of 453.50 g/mol. Its IUPAC name is (E)-N-benzyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-N-benzyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 135738149 |
| Molecular Formula | C27H23N3O4 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (E)-N-benzyl-3-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(4-oxo-3H-quinazolin-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCCO2)N(Cc1ccccc1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C27H23N3O4/c31-26(13-11-19-10-12-23-24(16-19)34-15-14-33-23)30(17-20-6-2-1-3-7-20)18-25-28-22-9-5-4-8-21(22)27(32)29-25/h1-13,16H,14-15,17-18H2,(H,28,29,32)/b13-11+ |
| InChIKey | KTPMLDQOZNUSNN-ACCUITESSA-N |
| XLogP | 3.94 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|