C15H20N4O4 — CID 135681168
ethyl (Z)-3-ethoxy-3-hydroxy-2-[(E)-N'-[(Z)-1-pyridin-2-ylethylideneamino]carbamimidoyl]prop-2-enoate (PubChem CID 135681168) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is ethyl (Z)-3-ethoxy-3-hydroxy-2-[(E)-N'-[(Z)-1-pyridin-2-ylethylideneamino]carbamimidoyl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-ethoxy-3-hydroxy-2-[(E)-N'-[(Z)-1-pyridin-2-ylethylideneamino]carbamimidoyl]prop-2-enoate |
|---|---|
| PubChem CID | 135681168 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | ethyl (Z)-3-ethoxy-3-hydroxy-2-[(E)-N'-[(Z)-1-pyridin-2-ylethylideneamino]carbamimidoyl]prop-2-enoate |
| SMILES | CCOC(=O)C(=C(/O)OCC)/C(N)=N\N=C(\C)c1ccccn1 |
| InChI | InChI=1S/C15H20N4O4/c1-4-22-14(20)12(15(21)23-5-2)13(16)19-18-10(3)11-8-6-7-9-17-11/h6-9,20H,4-5H2,1-3H3,(H2,16,19)/b14-12-,18-10- |
| InChIKey | IILTUDIFXGJCSB-MCZAMRHVSA-N |
| XLogP | 1.53 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|