C15H18N6O4 — CID 135682092
[2-methyl-4-[(E,3Z)-3-[1-methyl-3-(methylcarbamoyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-5-yl] N-methylmethanimidate (PubChem CID 135682092) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is [2-methyl-4-[(E,3Z)-3-[1-methyl-3-(methylcarbamoyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-5-yl] N-methylmethanimidate.
| Compound Name | [2-methyl-4-[(E,3Z)-3-[1-methyl-3-(methylcarbamoyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-5-yl] N-methylmethanimidate |
|---|---|
| PubChem CID | 135682092 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | [2-methyl-4-[(E,3Z)-3-[1-methyl-3-(methylcarbamoyl)-5-oxopyrazol-4-ylidene]prop-1-enyl]-3-oxo-1H-pyrazol-5-yl] N-methylmethanimidate |
| SMILES | C/N=C/Oc1[nH]n(C)c(=O)c1/C=C/C=C1\C(=O)N(C)N=C1C(=O)NC |
| InChI | InChI=1S/C15H18N6O4/c1-16-8-25-13-10(15(24)21(4)19-13)7-5-6-9-11(12(22)17-2)18-20(3)14(9)23/h5-8,19H,1-4H3,(H,17,22)/b7-5+,9-6-,16-8+ |
| InChIKey | XMZFYADHZPBUOJ-FKJYDJEUSA-N |
| XLogP | -0.74 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|