C15H18N6O4 — CID 91869602
N,1-dimethyl-4-[(E)-3-[2-methyl-5-(methylcarbamoyl)-3-oxo-1H-pyrazol-4-yl]prop-2-enylidene]-5-oxopyrazole-3-carboxamide (PubChem CID 91869602) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is N,1-dimethyl-4-[(E)-3-[2-methyl-5-(methylcarbamoyl)-3-oxo-1H-pyrazol-4-yl]prop-2-enylidene]-5-oxopyrazole-3-carboxamide.
| Compound Name | N,1-dimethyl-4-[(E)-3-[2-methyl-5-(methylcarbamoyl)-3-oxo-1H-pyrazol-4-yl]prop-2-enylidene]-5-oxopyrazole-3-carboxamide |
|---|---|
| PubChem CID | 91869602 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N,1-dimethyl-4-[(E)-3-[2-methyl-5-(methylcarbamoyl)-3-oxo-1H-pyrazol-4-yl]prop-2-enylidene]-5-oxopyrazole-3-carboxamide |
| SMILES | CNC(=O)C1=NN(C)C(=O)C1=C/C=C/c1c(C(=O)NC)[nH]n(C)c1=O |
| InChI | InChI=1S/C15H18N6O4/c1-16-12(22)10-8(14(24)20(3)18-10)6-5-7-9-11(13(23)17-2)19-21(4)15(9)25/h5-7,18H,1-4H3,(H,16,22)(H,17,23)/b6-5+,9-7? |
| InChIKey | URXPWFSOOBXGKX-CZUXNWOBSA-N |
| XLogP | -1.41 |
| TPSA | 128.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|