C15H18N4O2 — CID 22623433
(4Z)-4-[(2E,4E)-5-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-dimethylpyrazol-3-one (PubChem CID 22623433) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is (4Z)-4-[(2E,4E)-5-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-dimethylpyrazol-3-one.
| Compound Name | (4Z)-4-[(2E,4E)-5-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 22623433 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (4Z)-4-[(2E,4E)-5-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)penta-2,4-dienylidene]-2,5-dimethylpyrazol-3-one |
| SMILES | CC1=NN(C)C(=O)/C1=C\C=C\C=C\c1c(C)[nH]n(C)c1=O |
| InChI | InChI=1S/C15H18N4O2/c1-10-12(14(20)18(3)16-10)8-6-5-7-9-13-11(2)17-19(4)15(13)21/h5-9,16H,1-4H3/b7-5+,8-6+,13-9- |
| InChIKey | VNMJOAUUZLZZCV-XUUNKTRJSA-N |
| XLogP | 1.37 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|