C17H22N4O4 — CID 22623446
(4Z)-2-(2-hydroxyethyl)-4-[(2E,4E)-5-[2-(2-hydroxyethyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]penta-2,4-dienylidene]-5-methylpyrazol-3-one (PubChem CID 22623446) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is (4Z)-2-(2-hydroxyethyl)-4-[(2E,4E)-5-[2-(2-hydroxyethyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]penta-2,4-dienylidene]-5-methylpyrazol-3-one.
| Compound Name | (4Z)-2-(2-hydroxyethyl)-4-[(2E,4E)-5-[2-(2-hydroxyethyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]penta-2,4-dienylidene]-5-methylpyrazol-3-one |
|---|---|
| PubChem CID | 22623446 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (4Z)-2-(2-hydroxyethyl)-4-[(2E,4E)-5-[2-(2-hydroxyethyl)-5-methyl-3-oxo-1H-pyrazol-4-yl]penta-2,4-dienylidene]-5-methylpyrazol-3-one |
| SMILES | CC1=NN(CCO)C(=O)/C1=C\C=C\C=C\c1c(C)[nH]n(CCO)c1=O |
| InChI | InChI=1S/C17H22N4O4/c1-12-14(16(24)20(18-12)8-10-22)6-4-3-5-7-15-13(2)19-21(9-11-23)17(15)25/h3-7,18,22-23H,8-11H2,1-2H3/b5-3+,6-4+,15-7- |
| InChIKey | FFOWFOOODPNEDZ-IMLIWWCASA-N |
| XLogP | 0.18 |
| TPSA | 110.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|