C18H11FN2O2 — CID 135683156
2-(4-fluorophenyl)-4-[(Z)-indol-3-ylidenemethyl]-1,3-oxazol-5-ol (PubChem CID 135683156) has the molecular formula C18H11FN2O2 and a molecular weight of 306.30 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-[(Z)-indol-3-ylidenemethyl]-1,3-oxazol-5-ol.
| Compound Name | 2-(4-fluorophenyl)-4-[(Z)-indol-3-ylidenemethyl]-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 135683156 |
| Molecular Formula | C18H11FN2O2 |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-(4-fluorophenyl)-4-[(Z)-indol-3-ylidenemethyl]-1,3-oxazol-5-ol |
| SMILES | Oc1oc(-c2ccc(F)cc2)nc1/C=C1\C=Nc2ccccc21 |
| InChI | InChI=1S/C18H11FN2O2/c19-13-7-5-11(6-8-13)17-21-16(18(22)23-17)9-12-10-20-15-4-2-1-3-14(12)15/h1-10,22H/b12-9+ |
| InChIKey | MENSVEMYKCQLJJ-FMIVXFBMSA-N |
| XLogP | 4.44 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |