C32H25N5O — CID 135685731
3-[3-(1H-benzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]indazol-5-yl]-4-methylquinoline (PubChem CID 135685731) has the molecular formula C32H25N5O and a molecular weight of 495.59 g/mol. Its IUPAC name is 3-[3-(1H-benzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]indazol-5-yl]-4-methylquinoline.
| Compound Name | 3-[3-(1H-benzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]indazol-5-yl]-4-methylquinoline |
|---|---|
| PubChem CID | 135685731 |
| Molecular Formula | C32H25N5O |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 3-[3-(1H-benzimidazol-2-yl)-1-[(4-methoxyphenyl)methyl]indazol-5-yl]-4-methylquinoline |
| SMILES | COc1ccc(Cn2nc(-c3nc4ccccc4[nH]3)c3cc(-c4cnc5ccccc5c4C)ccc32)cc1 |
| InChI | InChI=1S/C32H25N5O/c1-20-24-7-3-4-8-27(24)33-18-26(20)22-13-16-30-25(17-22)31(32-34-28-9-5-6-10-29(28)35-32)36-37(30)19-21-11-14-23(38-2)15-12-21/h3-18H,19H2,1-2H3,(H,34,35) |
| InChIKey | XEJZFSQPFLXOGG-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |