C25H24IN5O — CID 135685761
1-[2-[5-iodo-1-[(4-methoxyphenyl)methyl]indazol-3-yl]-1H-benzimidazol-4-yl]-N,N-dimethylmethanamine (PubChem CID 135685761) has the molecular formula C25H24IN5O and a molecular weight of 537.41 g/mol. Its IUPAC name is 1-[2-[5-iodo-1-[(4-methoxyphenyl)methyl]indazol-3-yl]-1H-benzimidazol-4-yl]-N,N-dimethylmethanamine.
| Compound Name | 1-[2-[5-iodo-1-[(4-methoxyphenyl)methyl]indazol-3-yl]-1H-benzimidazol-4-yl]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 135685761 |
| Molecular Formula | C25H24IN5O |
| Molecular Weight | 537.41 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | 1-[2-[5-iodo-1-[(4-methoxyphenyl)methyl]indazol-3-yl]-1H-benzimidazol-4-yl]-N,N-dimethylmethanamine |
| SMILES | COc1ccc(Cn2nc(-c3nc4c(CN(C)C)cccc4[nH]3)c3cc(I)ccc32)cc1 |
| InChI | InChI=1S/C25H24IN5O/c1-30(2)15-17-5-4-6-21-23(17)28-25(27-21)24-20-13-18(26)9-12-22(20)31(29-24)14-16-7-10-19(32-3)11-8-16/h4-13H,14-15H2,1-3H3,(H,27,28) |
| InChIKey | AQMHSXFLUCMSFG-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.41 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|