C24H21FN2O4 — CID 135686199
2-[5-(2-fluorophenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol (PubChem CID 135686199) has the molecular formula C24H21FN2O4 and a molecular weight of 420.44 g/mol. Its IUPAC name is 2-[5-(2-fluorophenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol.
| Compound Name | 2-[5-(2-fluorophenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135686199 |
| Molecular Formula | C24H21FN2O4 |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[5-(2-fluorophenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C2=NN3C(C2)c2cccc(OC)c2OC3c2ccccc2F)c1 |
| InChI | InChI=1S/C24H21FN2O4/c1-29-14-10-11-21(28)17(12-14)19-13-20-16-7-5-9-22(30-2)23(16)31-24(27(20)26-19)15-6-3-4-8-18(15)25/h3-12,20,24,28H,13H2,1-2H3 |
| InChIKey | ZBHCDUADOZJNFZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|