C26H26N2O6 — CID 135686201
2-[5-(3,4-dimethoxyphenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol (PubChem CID 135686201) has the molecular formula C26H26N2O6 and a molecular weight of 462.50 g/mol. Its IUPAC name is 2-[5-(3,4-dimethoxyphenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol.
| Compound Name | 2-[5-(3,4-dimethoxyphenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol |
|---|---|
| PubChem CID | 135686201 |
| Molecular Formula | C26H26N2O6 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[5-(3,4-dimethoxyphenyl)-7-methoxy-5,10b-dihydro-1H-pyrazolo[1,5-c][1,3]benzoxazin-2-yl]-4-methoxyphenol |
| SMILES | COc1ccc(O)c(C2=NN3C(C2)c2cccc(OC)c2OC3c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C26H26N2O6/c1-30-16-9-10-21(29)18(13-16)19-14-20-17-6-5-7-23(32-3)25(17)34-26(28(20)27-19)15-8-11-22(31-2)24(12-15)33-4/h5-13,20,26,29H,14H2,1-4H3 |
| InChIKey | UFKCRTAIPXIATK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 81.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|