C16H17N3O — CID 135686640
1-(4-ethylphenyl)-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one (PubChem CID 135686640) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one.
| Compound Name | 1-(4-ethylphenyl)-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
|---|---|
| PubChem CID | 135686640 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 1-(4-ethylphenyl)-3,4-dimethyl-7H-pyrazolo[5,4-b]pyridin-6-one |
| SMILES | CCc1ccc(-n2nc(C)c3c(C)cc(=O)[nH]c32)cc1 |
| InChI | InChI=1S/C16H17N3O/c1-4-12-5-7-13(8-6-12)19-16-15(11(3)18-19)10(2)9-14(20)17-16/h5-9H,4H2,1-3H3,(H,17,20) |
| InChIKey | BCAQVNHYVLKQJB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |