C17H22I2N4O4 — CID 135686665
(NZ)-N-[[3-[3-[2-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-yl]oxypropoxy]-1-methylpyridin-1-ium-2-yl]methylidene]hydroxylamine diiodide (PubChem CID 135686665) has the molecular formula C17H22I2N4O4 and a molecular weight of 600.20 g/mol. Its IUPAC name is (NZ)-N-[[3-[3-[2-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-yl]oxypropoxy]-1-methylpyridin-1-ium-2-yl]methylidene]hydroxylamine diiodide.
| Compound Name | (NZ)-N-[[3-[3-[2-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-yl]oxypropoxy]-1-methylpyridin-1-ium-2-yl]methylidene]hydroxylamine diiodide |
|---|---|
| PubChem CID | 135686665 |
| Molecular Formula | C17H22I2N4O4 |
| Molecular Weight | 600.20 g/mol |
| Exact Mass | 599.97 |
| IUPAC Name | (NZ)-N-[[3-[3-[2-[(Z)-hydroxyiminomethyl]-1-methylpyridin-1-ium-3-yl]oxypropoxy]-1-methylpyridin-1-ium-2-yl]methylidene]hydroxylamine diiodide |
| SMILES | C[n+]1cccc(OCCCOc2ccc[n+](C)c2/C=N\O)c1/C=N\O.[I-].[I-] |
| InChI | InChI=1S/C17H20N4O4.2HI/c1-20-8-3-6-16(14(20)12-18-22)24-10-5-11-25-17-7-4-9-21(2)15(17)13-19-23;;/h3-4,6-9,12-13H,5,10-11H2,1-2H3;2*1H |
| InChIKey | RELKDBGRCAKZEA-UHFFFAOYSA-N |
| XLogP | -5.19 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.20 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|