C8H11N2O+ — CID 162648523
(NE)-N-[(1,3-dimethylpyridin-1-ium-2-yl)methylidene]hydroxylamine (PubChem CID 162648523) has the molecular formula C8H11N2O+ and a molecular weight of 151.19 g/mol. Its IUPAC name is (NE)-N-[(1,3-dimethylpyridin-1-ium-2-yl)methylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1,3-dimethylpyridin-1-ium-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 162648523 |
| Molecular Formula | C8H11N2O+ |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | (NE)-N-[(1,3-dimethylpyridin-1-ium-2-yl)methylidene]hydroxylamine |
| SMILES | Cc1ccc[n+](C)c1/C=N/O |
| InChI | InChI=1S/C8H10N2O/c1-7-4-3-5-10(2)8(7)6-9-11/h3-6H,1-2H3/p+1 |
| InChIKey | VZHMGQRCQHMTIG-UHFFFAOYSA-O |
| XLogP | 0.63 |
| TPSA | 36.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|